mirror of
https://github.com/curioustorvald/Terrarum.git
synced 2026-03-09 13:21:51 +09:00
world portal gui wip
This commit is contained in:
@@ -136,11 +136,11 @@ class UIItemInventoryCatBar(
|
||||
private val underlineColour = Color(0xeaeaea_40.toInt())
|
||||
private val underlineHighlightColour = mainButtons[0].highlightCol
|
||||
|
||||
private var highlighterXPos = mainButtons[selectedIndex].posX.toFloat()
|
||||
private var highlighterXPos = mainButtons[selectedIndex].posX
|
||||
private var highlighterXStart = highlighterXPos
|
||||
private var highlighterXEnd = highlighterXPos
|
||||
|
||||
private val highlighterYPos = catIcons.tileH + 4f
|
||||
private val highlighterYPos = catIcons.tileH + 4
|
||||
private var highlighterMoving = false
|
||||
private val highlighterMoveDuration: Second = 0.15f
|
||||
private var highlighterMoveTimer: Second = 0f
|
||||
@@ -196,11 +196,11 @@ class UIItemInventoryCatBar(
|
||||
highlighterMoveTimer += delta
|
||||
|
||||
highlighterXPos = Movement.moveQuick(
|
||||
highlighterXStart,
|
||||
highlighterXEnd,
|
||||
highlighterXStart.toFloat(),
|
||||
highlighterXEnd.toFloat(),
|
||||
highlighterMoveTimer,
|
||||
highlighterMoveDuration
|
||||
)
|
||||
).roundToInt()
|
||||
|
||||
if (highlighterMoveTimer > highlighterMoveDuration) {
|
||||
highlighterMoveTimer = 0f
|
||||
@@ -224,10 +224,10 @@ class UIItemInventoryCatBar(
|
||||
// normal stuffs
|
||||
val oldIndex = selectedIndex
|
||||
|
||||
highlighterXStart = mainButtons[selectedIndex].posX.toFloat() // using old selectedIndex
|
||||
highlighterXStart = mainButtons[selectedIndex].posX // using old selectedIndex
|
||||
selectedIndex = index
|
||||
highlighterMoving = true
|
||||
highlighterXEnd = mainButtons[selectedIndex].posX.toFloat() // using new selectedIndex
|
||||
highlighterXEnd = mainButtons[selectedIndex].posX // using new selectedIndex
|
||||
|
||||
selectionChangeListener?.invoke(oldIndex, index)
|
||||
}
|
||||
@@ -290,12 +290,12 @@ class UIItemInventoryCatBar(
|
||||
if (selectedPanel == 1) {
|
||||
// indicator
|
||||
batch.color = underlineHighlightColour
|
||||
batch.draw(underlineIndTex, (highlighterXPos - buttonGapSize / 2).round(), posY + highlighterYPos)
|
||||
batch.draw(underlineIndTex, (highlighterXPos - buttonGapSize / 2), posY + highlighterYPos.toFloat())
|
||||
|
||||
// label
|
||||
batch.color = Color.WHITE
|
||||
catIconsLabels[selectedIcon]().let {
|
||||
App.fontGame.draw(batch, it, posX + ((width - App.fontGame.getWidth(it)) / 2).toFloat(), posY + highlighterYPos + 4)
|
||||
App.fontGame.draw(batch, it, posX + ((width - App.fontGame.getWidth(it)) / 2), posY + highlighterYPos + 4)
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -40,8 +40,12 @@ class UIInventoryFull(
|
||||
|
||||
const val REQUIRED_MARGIN: Int = 138 // hard-coded value. Don't know the details. Range: [91-146]. I chose MAX-8 because cell gap is 8
|
||||
const val CELLS_HOR = 10
|
||||
val CELLS_VRT: Int; get() = (App.scr.height - REQUIRED_MARGIN - 134 + UIItemInventoryItemGrid.listGap) / // 134 is another magic number
|
||||
(UIItemInventoryElemSimple.height + UIItemInventoryItemGrid.listGap)
|
||||
|
||||
fun getCellCountVertically(cellHeight: Int, gapHeight: Int = UIItemInventoryItemGrid.listGap): Int {
|
||||
return (App.scr.height - REQUIRED_MARGIN - 134 + gapHeight) / // 134 is another magic number
|
||||
(cellHeight + gapHeight)
|
||||
}
|
||||
val CELLS_VRT: Int; get() = getCellCountVertically(UIItemInventoryElemSimple.height, UIItemInventoryItemGrid.listGap)
|
||||
|
||||
const val itemListToEquipViewGap = UIItemInventoryItemGrid.listGap // used to be 24; figured out that the extra gap does nothig
|
||||
|
||||
|
||||
@@ -532,7 +532,7 @@ class UIItemPlayerCells(
|
||||
|
||||
private val litCol = Toolkit.Theme.COL_MOUSE_UP
|
||||
private val cellCol = CELL_COL
|
||||
private val defaultCol = Color.WHITE
|
||||
private val defaultCol = Toolkit.Theme.COL_LIST_DEFAULT
|
||||
private val hruleCol = Color(1f,1f,1f,0.35f)
|
||||
private val hruleColLit = litCol.cpy().sub(0f,0f,0f,0.65f)
|
||||
|
||||
@@ -734,7 +734,7 @@ class UIItemWorldCells(
|
||||
private val colourBad = Color(0xFF0011FF.toInt())
|
||||
private val cellCol = CELL_COL
|
||||
|
||||
private var highlightCol: Color = Color.WHITE
|
||||
private var highlightCol: Color = Toolkit.Theme.COL_LIST_DEFAULT
|
||||
|
||||
override var clickOnceListener: ((Int, Int, Int) -> Unit)? = { _: Int, _: Int, _: Int ->
|
||||
UILoadGovernor.worldDisk = skimmer
|
||||
@@ -746,7 +746,7 @@ class UIItemWorldCells(
|
||||
|
||||
override fun update(delta: Float) {
|
||||
super.update(delta)
|
||||
highlightCol = if (mouseUp) Toolkit.Theme.COL_MOUSE_UP else Color.WHITE
|
||||
highlightCol = if (mouseUp) Toolkit.Theme.COL_MOUSE_UP else Toolkit.Theme.COL_LIST_DEFAULT
|
||||
}
|
||||
|
||||
override fun render(batch: SpriteBatch, camera: Camera) {
|
||||
|
||||
@@ -86,8 +86,6 @@ class UINewWorld(val remoCon: UIRemoCon) : UICanvas() {
|
||||
private val goButton = UIItemTextButton(this, "MENU_LABEL_CONFIRM_BUTTON", drawX + width/2 + (width/2 - goButtonWidth) / 2, drawY + height - 24, goButtonWidth, true, alignment = UIItemTextButton.Companion.Alignment.CENTRE, hasBorder = true)
|
||||
|
||||
init {
|
||||
tex.forEach { it.flip(false, false) }
|
||||
|
||||
goButton.touchDownListener = { _, _, _, _ ->
|
||||
// printdbg(this, "generate! Size=${sizeSelector.selection}, Name=${nameInput.getTextOrPlaceholder()}, Seed=${seedInput.getTextOrPlaceholder()}")
|
||||
|
||||
|
||||
@@ -4,9 +4,15 @@ import com.badlogic.gdx.graphics.Camera
|
||||
import com.badlogic.gdx.graphics.Color
|
||||
import com.badlogic.gdx.graphics.g2d.SpriteBatch
|
||||
import net.torvald.terrarum.*
|
||||
import net.torvald.terrarum.ui.Toolkit
|
||||
import net.torvald.terrarum.ui.UICanvas
|
||||
import net.torvald.terrarum.ui.UIItemHorizontalFadeSlide
|
||||
import net.torvald.terrarum.langpack.Lang
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIInventoryFull.Companion.INVENTORY_CELLS_OFFSET_Y
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIInventoryFull.Companion.YPOS_CORRECTION
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIInventoryFull.Companion.drawBackground
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIInventoryFull.Companion.internalHeight
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIInventoryFull.Companion.internalWidth
|
||||
import net.torvald.terrarum.ui.*
|
||||
import net.torvald.terrarumsansbitmap.gdx.TextureRegionPack
|
||||
import net.torvald.unicode.getKeycapPC
|
||||
|
||||
/**
|
||||
* Structure:
|
||||
@@ -23,8 +29,8 @@ class UIWorldPortal : UICanvas(
|
||||
toggleButtonLiteral = App.getConfigInt("control_gamepad_start"),
|
||||
) {
|
||||
|
||||
override var width = App.scr.width
|
||||
override var height = App.scr.height
|
||||
override var width: Int = Toolkit.drawWidth
|
||||
override var height: Int = App.scr.height
|
||||
|
||||
|
||||
|
||||
@@ -41,23 +47,30 @@ class UIWorldPortal : UICanvas(
|
||||
fun requestTransition(target: Int) = transitionPanel.requestTransition(target)
|
||||
|
||||
|
||||
val catBar = UIItemInventoryCatBar(
|
||||
val catBar = UIItemWorldPortalTopBar(
|
||||
this,
|
||||
(width - UIInventoryFull.catBarWidth) / 2,
|
||||
42 - UIInventoryFull.YPOS_CORRECTION + (App.scr.height - UIInventoryFull.internalHeight) / 2,
|
||||
UIInventoryFull.internalWidth,
|
||||
UIInventoryFull.catBarWidth,
|
||||
true
|
||||
0,
|
||||
42 - YPOS_CORRECTION + (App.scr.height - internalHeight) / 2,
|
||||
) { i -> if (!panelTransitionLocked) requestTransition(i) }
|
||||
|
||||
|
||||
private val SP = "\u3000 "
|
||||
val portalListingControlHelp: String
|
||||
get() = if (App.environment == RunningEnvironment.PC)
|
||||
"${getKeycapPC(App.getConfigInt("control_key_inventory"))} ${Lang["GAME_ACTION_CLOSE"]}"
|
||||
else
|
||||
"${App.gamepadLabelStart} ${Lang["GAME_ACTION_CLOSE"]}" +
|
||||
"$SP${App.gamepadLabelLT} ${Lang["GAME_WORLD_SEARCH"]}" +
|
||||
"$SP${App.gamepadLabelRT} ${Lang["GAME_INVENTORY"]}"
|
||||
|
||||
|
||||
private val transitionalSearch = UIWorldPortalSearch(this)
|
||||
private val transitionalListing = UIWorldPortalListing(this)
|
||||
private val transitionalCargo = UIWorldPortalCargo(this)
|
||||
private val transitionPanel = UIItemHorizontalFadeSlide(
|
||||
this,
|
||||
(width - UIInventoryFull.internalWidth) / 2,
|
||||
UIInventoryFull.INVENTORY_CELLS_OFFSET_Y(),
|
||||
(width - internalWidth) / 2,
|
||||
INVENTORY_CELLS_OFFSET_Y(),
|
||||
width,
|
||||
App.scr.height,
|
||||
1f,
|
||||
@@ -72,7 +85,10 @@ class UIWorldPortal : UICanvas(
|
||||
|
||||
}
|
||||
|
||||
|
||||
internal var xEnd = (width + internalWidth).div(2).toFloat()
|
||||
private set
|
||||
internal var yEnd = -YPOS_CORRECTION + (App.scr.height + internalHeight).div(2).toFloat()
|
||||
private set
|
||||
|
||||
|
||||
|
||||
@@ -82,7 +98,7 @@ class UIWorldPortal : UICanvas(
|
||||
}
|
||||
|
||||
override fun renderUI(batch: SpriteBatch, camera: Camera) {
|
||||
UIInventoryFull.drawBackground(batch, handler.opacity)
|
||||
drawBackground(batch, handler.opacity)
|
||||
|
||||
// UI items
|
||||
catBar.render(batch, camera)
|
||||
@@ -123,4 +139,83 @@ class UIWorldPortal : UICanvas(
|
||||
INGAME.setTooltipMessage(null) // required!
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
class UIItemWorldPortalTopBar(
|
||||
parentUI: UIWorldPortal,
|
||||
initialX: Int,
|
||||
initialY: Int,
|
||||
val panelTransitionReqFun: (Int) -> Unit = {} // for side buttons; for the selection change, override selectionChangeListener
|
||||
) : UIItem(parentUI, initialX, initialY) {
|
||||
|
||||
override val width = 580
|
||||
override val height = 25
|
||||
|
||||
init {
|
||||
CommonResourcePool.addToLoadingList("terrarum-basegame-worldportalicons") {
|
||||
TextureRegionPack(ModMgr.getGdxFile("basegame", "gui/worldportal_catbar.tga"), 20, 20)
|
||||
}
|
||||
CommonResourcePool.loadAll()
|
||||
}
|
||||
|
||||
private val genericIcons: TextureRegionPack = CommonResourcePool.getAsTextureRegionPack("inventory_category")
|
||||
private val icons = CommonResourcePool.getAsTextureRegionPack("terrarum-basegame-worldportalicons")
|
||||
private val catIconImages = listOf(
|
||||
icons.get(0, 0),
|
||||
genericIcons.get(16,0),
|
||||
icons.get(1, 0),
|
||||
genericIcons.get(17,0),
|
||||
icons.get(2, 0),
|
||||
)
|
||||
private val catIconLabels = listOf(
|
||||
"CONTEXT_WORLD_SEARCH",
|
||||
"",
|
||||
"CONTEXT_WORLD_LIST",
|
||||
"GAME_INVENTORY",
|
||||
"",
|
||||
)
|
||||
private val buttonGapSize = 120
|
||||
private val highlighterYPos = icons.tileH + 4
|
||||
|
||||
var selection = 2
|
||||
|
||||
private val buttons = Array<UIItemImageButton>(5) {
|
||||
val xoff = if (it == 1) -32 else if (it == 3) 32 else 0
|
||||
UIItemImageButton(
|
||||
parentUI,
|
||||
catIconImages[it],
|
||||
activeBackCol = Color(0),
|
||||
backgroundCol = Color(0),
|
||||
highlightBackCol = Color(0),
|
||||
activeBackBlendMode = BlendMode.NORMAL,
|
||||
initialX = (Toolkit.drawWidth - width) / 2 + it * (buttonGapSize + 20) + xoff,
|
||||
initialY = posY,
|
||||
inactiveCol = if (it % 2 == 0) Color.WHITE else Color(0xffffff7f.toInt()),
|
||||
activeCol = if (it % 2 == 0) Toolkit.Theme.COL_MOUSE_UP else Color(0xffffff7f.toInt()),
|
||||
highlightable = (it % 2 == 0)
|
||||
)
|
||||
}
|
||||
|
||||
override fun render(batch: SpriteBatch, camera: Camera) {
|
||||
super.render(batch, camera)
|
||||
|
||||
// button
|
||||
buttons.forEach { it.render(batch, camera) }
|
||||
|
||||
// label
|
||||
batch.color = Color.WHITE
|
||||
val text = Lang[catIconLabels[selection]]
|
||||
App.fontGame.draw(batch, text, buttons[selection].posX + 10 - (App.fontGame.getWidth(text) / 2), posY + highlighterYPos + 4)
|
||||
|
||||
|
||||
blendNormalStraightAlpha(batch)
|
||||
|
||||
|
||||
|
||||
}
|
||||
|
||||
override fun dispose() {
|
||||
}
|
||||
|
||||
|
||||
}
|
||||
@@ -2,19 +2,18 @@ package net.torvald.terrarum.modulebasegame.ui
|
||||
|
||||
import com.badlogic.gdx.graphics.Camera
|
||||
import com.badlogic.gdx.graphics.Color
|
||||
import com.badlogic.gdx.graphics.Texture
|
||||
import com.badlogic.gdx.graphics.g2d.SpriteBatch
|
||||
import com.badlogic.gdx.graphics.g2d.TextureRegion
|
||||
import com.badlogic.gdx.utils.Json
|
||||
import com.badlogic.gdx.utils.GdxRuntimeException
|
||||
import net.torvald.terrarum.*
|
||||
import net.torvald.terrarum.gameactors.AVKey
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIInventoryFull.Companion.INVENTORY_CELLS_OFFSET_Y
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIItemInventoryItemGrid.Companion.listGap
|
||||
import net.torvald.terrarum.modulebasegame.ui.UIInventoryFull.Companion.getCellCountVertically
|
||||
import net.torvald.terrarum.realestate.LandUtil.CHUNK_H
|
||||
import net.torvald.terrarum.realestate.LandUtil.CHUNK_W
|
||||
import net.torvald.terrarum.savegame.ByteArray64Reader
|
||||
import net.torvald.terrarum.savegame.DiskSkimmer
|
||||
import net.torvald.terrarum.savegame.EntryFile
|
||||
import net.torvald.terrarum.serialise.Common
|
||||
import net.torvald.terrarum.serialise.ascii85toUUID
|
||||
import net.torvald.terrarum.ui.Toolkit
|
||||
import net.torvald.terrarum.ui.UICanvas
|
||||
@@ -22,8 +21,8 @@ import net.torvald.terrarum.ui.UIItem
|
||||
import net.torvald.terrarum.ui.UIItemTextButton
|
||||
import net.torvald.terrarum.utils.JsonFetcher
|
||||
import net.torvald.terrarumsansbitmap.gdx.TextureRegionPack
|
||||
import net.torvald.unicode.EMDASH
|
||||
import java.util.*
|
||||
import kotlin.math.roundToInt
|
||||
|
||||
/**
|
||||
* Created by minjaesong on 2023-05-19.
|
||||
@@ -34,27 +33,19 @@ class UIWorldPortalListing(val full: UIWorldPortal) : UICanvas() {
|
||||
override var width: Int = Toolkit.drawWidth
|
||||
override var height: Int = App.scr.height
|
||||
|
||||
private val cellHeight = 48
|
||||
private val buttonHeight = 24
|
||||
private val gridGap = listGap
|
||||
private val gridGap = 10
|
||||
|
||||
private val worldList = ArrayList<WorldInfo>()
|
||||
private var selectedWorld: DiskSkimmer? = null
|
||||
|
||||
|
||||
private val cellCol = UIInventoryFull.CELL_COL
|
||||
private var highlightCol: Color = Color.WHITE
|
||||
|
||||
|
||||
|
||||
|
||||
private val thumbw = 360
|
||||
private val thumbh = 240
|
||||
private val hx = Toolkit.drawWidth.div(2)
|
||||
private val y = INVENTORY_CELLS_OFFSET_Y()
|
||||
private val y = INVENTORY_CELLS_OFFSET_Y() + 1
|
||||
|
||||
private val listCount = UIInventoryFull.CELLS_VRT
|
||||
private val listHeight = cellHeight * listCount + gridGap * (listCount - 1)
|
||||
private val listCount = getCellCountVertically(UIItemWorldCellsSimple.height, gridGap)
|
||||
private val listHeight = UIItemWorldCellsSimple.height + (listCount - 1) * (UIItemWorldCellsSimple.height + gridGap)
|
||||
|
||||
private val memoryGaugeWidth = 360
|
||||
private val deleteButtonWidth = (memoryGaugeWidth - gridGap) / 2
|
||||
@@ -80,7 +71,8 @@ class UIWorldPortalListing(val full: UIWorldPortal) : UICanvas() {
|
||||
data class WorldInfo(
|
||||
val uuid: UUID,
|
||||
val diskSkimmer: DiskSkimmer,
|
||||
val dimensionInChunks: Int
|
||||
val dimensionInChunks: Int,
|
||||
val seed: Long
|
||||
)
|
||||
|
||||
init {
|
||||
@@ -98,30 +90,49 @@ class UIWorldPortalListing(val full: UIWorldPortal) : UICanvas() {
|
||||
private var chunksUsed = 0
|
||||
private val chunksMax = 100000
|
||||
|
||||
private lateinit var worldCells: Array<UIItemWorldCellsSimple>
|
||||
|
||||
override fun show() {
|
||||
worldList.clear()
|
||||
worldList.addAll((INGAME.actorGamer.actorValue.getAsString(AVKey.WORLD_PORTAL_DICT) ?: "").split(",").filter { it.isNotBlank() }.map {
|
||||
it.ascii85toUUID().let { it to App.savegameWorlds[it] }
|
||||
}.filter { it.second != null }.map { (uuid, disk) ->
|
||||
chunksUsed = worldList.sumOf {
|
||||
var chunksCount = 0
|
||||
var seed = 0L
|
||||
worldList.forEach {
|
||||
var w = 0
|
||||
var h = 0
|
||||
JsonFetcher.readFromJsonString(ByteArray64Reader((disk!!.requestFile(-1)!!.contents.getContent() as EntryFile).bytes, Charsets.UTF_8)).let {
|
||||
JsonFetcher.readFromJsonString(ByteArray64Reader((disk!!.requestFile(-1)!!.contents.getContent() as EntryFile).bytes, Common.CHARSET)).let {
|
||||
JsonFetcher.forEachSiblings(it) { name, value ->
|
||||
if (name == "width") w = value.asInt()
|
||||
if (name == "height") h = value.asInt()
|
||||
if (name == "generatorSeed") seed = value.asLong()
|
||||
}
|
||||
}
|
||||
(w / CHUNK_W) * (h / CHUNK_H)
|
||||
chunksCount = (w / CHUNK_W) * (h / CHUNK_H)
|
||||
}
|
||||
WorldInfo(uuid, disk!!, chunksUsed)
|
||||
WorldInfo(uuid, disk!!, chunksCount, seed)
|
||||
} as List<WorldInfo>)
|
||||
|
||||
chunksUsed = worldList.sumOf { it.dimensionInChunks }
|
||||
|
||||
worldCells = Array(maxOf(worldList.size, listCount)) {
|
||||
UIItemWorldCellsSimple(
|
||||
this,
|
||||
hx + gridGap / 2,
|
||||
y + (gridGap + UIItemWorldCellsSimple.height) * it,
|
||||
worldList.getOrNull(it),
|
||||
worldList.getOrNull(it)?.diskSkimmer?.getDiskName(Common.CHARSET)
|
||||
)
|
||||
}
|
||||
|
||||
uiItems.forEach { it.show() }
|
||||
worldCells.forEach { it.show() }
|
||||
}
|
||||
|
||||
override fun updateUI(delta: Float) {
|
||||
|
||||
uiItems.forEach { it.update(delta) }
|
||||
worldCells.forEach { it.update(delta) }
|
||||
}
|
||||
|
||||
|
||||
@@ -132,13 +143,13 @@ class UIWorldPortalListing(val full: UIWorldPortal) : UICanvas() {
|
||||
|
||||
// draw background //
|
||||
// screencap panel
|
||||
batch.color = cellCol
|
||||
batch.color = UIInventoryFull.CELL_COL
|
||||
Toolkit.fillArea(batch, hx - thumbw - gridGap/2, y, thumbw, thumbh)
|
||||
|
||||
|
||||
// draw border //
|
||||
// screencap panel
|
||||
batch.color = highlightCol
|
||||
batch.color = Toolkit.Theme.COL_LIST_DEFAULT
|
||||
Toolkit.drawBoxBorder(batch, hx - thumbw - gridGap/2 - 1, y - 1, thumbw + 2, thumbh + 2)
|
||||
|
||||
|
||||
@@ -156,27 +167,81 @@ class UIWorldPortalListing(val full: UIWorldPortal) : UICanvas() {
|
||||
|
||||
|
||||
uiItems.forEach { it.render(batch, camera) }
|
||||
worldCells.forEach { it.render(batch, camera) }
|
||||
|
||||
// control hints
|
||||
batch.color = Color.WHITE
|
||||
App.fontGame.draw(batch, full.portalListingControlHelp, (hx - thumbw - gridGap/2).toInt(), (full.yEnd - 20).toInt())
|
||||
}
|
||||
|
||||
override fun hide() {
|
||||
uiItems.forEach { it.hide() }
|
||||
worldCells.forEach { it.hide() }
|
||||
|
||||
worldCells.forEach { try { it.dispose() } catch (_: GdxRuntimeException) {} }
|
||||
}
|
||||
|
||||
override fun dispose() {
|
||||
|
||||
uiItems.forEach { it.dispose() }
|
||||
worldCells.forEach { try { it.dispose() } catch (_: GdxRuntimeException) {} }
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
class UIItemWorldCellsSimple(
|
||||
parent: UILoadDemoSavefiles,
|
||||
parent: UIWorldPortalListing,
|
||||
initialX: Int,
|
||||
initialY: Int,
|
||||
val skimmer: DiskSkimmer
|
||||
internal val worldInfo: UIWorldPortalListing.WorldInfo? = null,
|
||||
internal val worldName: String? = null,
|
||||
) : UIItem(parent, initialX, initialY) {
|
||||
|
||||
companion object {
|
||||
const val width = 360
|
||||
const val height = 46
|
||||
}
|
||||
|
||||
override val width: Int = 360
|
||||
override val height: Int = 46
|
||||
|
||||
private val cellCol = UIInventoryFull.CELL_COL
|
||||
private var highlightCol: Color = Color.WHITE
|
||||
private val icons = CommonResourcePool.getAsTextureRegionPack("terrarum-basegame-worldportalicons")
|
||||
|
||||
|
||||
override fun show() {
|
||||
super.show()
|
||||
}
|
||||
|
||||
override fun hide() {
|
||||
super.hide()
|
||||
}
|
||||
|
||||
override fun update(delta: Float) {
|
||||
super.update(delta)
|
||||
}
|
||||
|
||||
override fun render(batch: SpriteBatch, camera: Camera) {
|
||||
super.render(batch, camera)
|
||||
|
||||
|
||||
// draw background
|
||||
batch.color = UIInventoryFull.CELL_COL
|
||||
Toolkit.fillArea(batch, posX, posY, width, height)
|
||||
|
||||
// draw border
|
||||
val bcol = if (mouseUp && mousePushed) Toolkit.Theme.COL_SELECTED
|
||||
else if (mouseUp) Toolkit.Theme.COL_MOUSE_UP else Toolkit.Theme.COL_LIST_DEFAULT
|
||||
batch.color = bcol
|
||||
Toolkit.drawBoxBorder(batch, posX - 1, posY - 1, width + 2, height + 2)
|
||||
// draw texts
|
||||
batch.draw(icons.get(0, 1), posX + 4f, posY + 1f)
|
||||
App.fontGame.draw(batch, worldName ?: "$EMDASH", posX + 32, posY + 1)
|
||||
batch.draw(icons.get(1, 1), posX + 4f, posY + 25f)
|
||||
App.fontGame.draw(batch, if (worldInfo?.seed == null) "$EMDASH" else "${(if (worldInfo.seed > 0) " + " else "")}${worldInfo.seed}" , posX + 32, posY + 25)
|
||||
// text separator
|
||||
batch.color = bcol.cpy().sub(0f,0f,0f,0.65f)
|
||||
Toolkit.fillArea(batch, posX + 2, posY + 23, width - 4, 1)
|
||||
|
||||
}
|
||||
|
||||
override fun dispose() {
|
||||
}
|
||||
|
||||
@@ -22,7 +22,7 @@ object Toolkit : Disposable {
|
||||
val COL_INVENTORY_CELL_BORDER = Color(1f, 1f, 1f, 0.25f)
|
||||
val COL_CELL_FILL = Color(0x282828C8)
|
||||
|
||||
val COL_LIST_DEFAULT = Color.WHITE
|
||||
val COL_LIST_DEFAULT = Color.WHITE // white
|
||||
val COL_INACTIVE = Color.LIGHT_GRAY
|
||||
val COL_SELECTED = Color(0x00f8ff_ff) // cyan, HIGHLY SATURATED
|
||||
val COL_MOUSE_UP = Color(0xfff066_ff.toInt()) // yellow (all yellows are of low saturation according to the colour science)
|
||||
|
||||
Reference in New Issue
Block a user